9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene
![9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene Structure](https://image.chemsrc.com/caspic/402/69656-49-1.png)
9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene structure
|
Common Name | 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene | ||
|---|---|---|---|---|
| CAS Number | 69656-49-1 | Molecular Weight | 241.40200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23NO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H23NO2Si |
|---|---|
| Molecular Weight | 241.40200 |
| Exact Mass | 241.15000 |
| PSA | 21.70000 |
| LogP | 2.08520 |
| InChIKey | WUYIYIAXOVLCJA-UHFFFAOYSA-N |
| SMILES | CCCCN1CCO[Si]2(CC=CC2)OCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~75%
9-butyl-6,12-di... CAS#:69656-49-1 |
| Literature: Chernyshev, E. A.; Komalenkova, N. G.; Bashkirova, S. A.; Popov, A. G.; Antipova, V. V. J. Gen. Chem. USSR (Engl. Transl.), 1983 , vol. 53, # 12 p. 2725 - 2728,2455 - 2457 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene? |
| A: The English name of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene is 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene. |
| Q: What is the Chinese name of 69656-49-1? |
| A: Chinese name of 69656-49-1 is 69656-49-1. |
| Q: What is the SMILES notation of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene? |
| A: SMILES notation of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene is CCCCN1CCO[Si]2(CC=CC2)OCC1. |
| Q: What is the molecular formula of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene? |
| A: Molecular formula of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene is C12H23NO2Si. |
| Q: What are the upstream materials of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene? |
| A: Related upstream materials(CAS) of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene: 102-79-4;61667-33-2. |
| Q: What is the polar surface area (PSA) of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene? |
| A: Polar surface area (PSA) of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene is 21.70000. |
| Q: What is the LogP of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene? |
| A: LogP of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene is 2.08520. |
| Q: What is the molecular weight of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene? |
| A: Molecular weight of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene is 241.40200. |
| Q: What is the CAS number of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene? |
| A: CAS number of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene is 69656-49-1. |
| Q: What is the InChIKey of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene? |
| A: InChIKey of 9-butyl-6,12-dioxa-9-aza-5-silaspiro[4.7]dodec-2-ene is WUYIYIAXOVLCJA-UHFFFAOYSA-N. |