Morpholine,4-(2,5-dimethyl-1H-pyrrol-1-yl)-2,6-dimethyl- structure
|
Common Name | Morpholine,4-(2,5-dimethyl-1H-pyrrol-1-yl)-2,6-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 6966-92-3 | Molecular Weight | 208.30000 | |
| Density | 1.07g/cm3 | Boiling Point | 316.7ºC at 760mmHg | |
| Molecular Formula | C12H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.3ºC | |
| Name | 2,6-Dimetoxybenzophenon |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 316.7ºC at 760mmHg |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30000 |
| Flash Point | 145.3ºC |
| Exact Mass | 208.15800 |
| PSA | 17.40000 |
| LogP | 1.91510 |
| Index of Refraction | 1.546 |
| InChIKey | PDFKGFYBMKNMDZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)n1N1CC(C)OC(C)C1 |
|
~29%
Morpholine,4-(2... CAS#:6966-92-3 |
| Literature: Broadbent,H.S. et al. Journal of Heterocyclic Chemistry, 1968 , vol. 5, p. 757 - 767 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,6-dimethoxy-benzophenone |
| 2,6-Dimethoxybenzophenon |