methyl 3-amino-4-piperidin-1-ylbenzoate structure
|
Common Name | methyl 3-amino-4-piperidin-1-ylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 696616-81-6 | Molecular Weight | 234.29400 | |
| Density | 1.16g/cm3 | Boiling Point | 414.6ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.6ºC | |
| Name | methyl 3-amino-4-piperidin-1-ylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 414.6ºC at 760 mmHg |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.29400 |
| Flash Point | 204.6ºC |
| Exact Mass | 234.13700 |
| PSA | 55.56000 |
| LogP | 2.69190 |
| Index of Refraction | 1.578 |
| InChIKey | NQQHRVRQXJDWRF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N2CCCCC2)c(N)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 3-amino-4-piperidylbenzoate |