3-amino-benzo[c]chromen-6-one structure
|
Common Name | 3-amino-benzo[c]chromen-6-one | ||
|---|---|---|---|---|
| CAS Number | 6967-04-0 | Molecular Weight | 211.21600 | |
| Density | 1.354g/cm3 | Boiling Point | 438.8ºC at 760 mmHg | |
| Molecular Formula | C13H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.9ºC | |
| Name | 3-amino-benzo[c]chromen-6-one |
|---|
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 438.8ºC at 760 mmHg |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.21600 |
| Flash Point | 261.9ºC |
| Exact Mass | 211.06300 |
| PSA | 56.23000 |
| LogP | 3.10960 |
| Index of Refraction | 1.692 |
| InChIKey | YQQVBNFLJJKBGW-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)oc(=O)c1ccccc12 |
|
~%
3-amino-benzo[c... CAS#:6967-04-0 |
| Literature: Liu, Yugang; Lu, Yansong; Prashad, Mahavir; Repic, Oljan; Blacklock, Thomas J. Advanced Synthesis and Catalysis, 2005 , vol. 347, # 2-3 p. 217 - 219 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |