N-(2,4-dimethylphenyl)-4-methyl-3-nitro-benzamide structure
|
Common Name | N-(2,4-dimethylphenyl)-4-methyl-3-nitro-benzamide | ||
|---|---|---|---|---|
| CAS Number | 6967-11-9 | Molecular Weight | 284.31000 | |
| Density | 1.497g/cm3 | Boiling Point | 578ºC at 760 mmHg | |
| Molecular Formula | C16H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.4ºC | |
| Name | N-(2,4-dimethylphenyl)-4-methyl-3-nitrobenzamide |
|---|
| Density | 1.497g/cm3 |
|---|---|
| Boiling Point | 578ºC at 760 mmHg |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31000 |
| Flash Point | 303.4ºC |
| Exact Mass | 284.11600 |
| PSA | 74.92000 |
| LogP | 4.36850 |
| Index of Refraction | 1.586 |
| InChIKey | HZUYHCXRFOCYRF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2ccc(C)c([N+](=O)[O-])c2)c(C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |