N-(2,4-dichlorophenyl)-N-(2-furylmethylideneamino)butanediamide structure
|
Common Name | N-(2,4-dichlorophenyl)-N-(2-furylmethylideneamino)butanediamide | ||
|---|---|---|---|---|
| CAS Number | 6967-14-2 | Molecular Weight | 243.19000 | |
| Density | 1.511g/cm3 | Boiling Point | 430.4ºC at 760 mmHg | |
| Molecular Formula | C13H6FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.1ºC | |
| Name | 2-Fluoro-7-nitro-fluoren-9-on |
|---|---|
| Synonym | More Synonyms |
| Density | 1.511g/cm3 |
|---|---|
| Boiling Point | 430.4ºC at 760 mmHg |
| Molecular Formula | C13H6FNO3 |
| Molecular Weight | 243.19000 |
| Flash Point | 214.1ºC |
| Exact Mass | 243.03300 |
| PSA | 62.89000 |
| LogP | 3.46850 |
| Index of Refraction | 1.675 |
| InChIKey | HUHRCVLBGZUGKR-UHFFFAOYSA-N |
| SMILES | O=C1c2cc(F)ccc2-c2ccc([N+](=O)[O-])cc21 |
|
~%
N-(2,4-dichloro... CAS#:6967-14-2 |
| Literature: Minabe,M. et al. Bulletin of the Chemical Society of Japan, 1971 , vol. 44, p. 1614 - 1619 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Fluoro-6-vinylpyridine |