4,6-Pteridinedione,1,2,3,5-tetrahydro-7-methyl-2-thioxo- (9CI) structure
|
Common Name | 4,6-Pteridinedione,1,2,3,5-tetrahydro-7-methyl-2-thioxo- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6967-57-3 | Molecular Weight | 210.21300 | |
| Density | 1.92g/cm3 | Boiling Point | 562.5ºC at 760 mmHg | |
| Molecular Formula | C7H6N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294ºC | |
| Name | 7-methyl-2-sulfanylidene-1,5-dihydropteridine-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.92g/cm3 |
|---|---|
| Boiling Point | 562.5ºC at 760 mmHg |
| Molecular Formula | C7H6N4O2S |
| Molecular Weight | 210.21300 |
| Flash Point | 294ºC |
| Exact Mass | 210.02100 |
| PSA | 130.82000 |
| LogP | 0.42810 |
| Index of Refraction | 1.895 |
| InChIKey | ASXQSQWURKMTJE-UHFFFAOYSA-N |
| SMILES | Cc1nc2[nH]c(=S)[nH]c(=O)c2[nH]c1=O |
| HS Code | 2933990090 |
|---|
|
~%
4,6-Pteridinedi... CAS#:6967-57-3 |
| Literature: Gal Journal of the American Chemical Society, 1950 , vol. 72, p. 3532 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Methyl-2-thioxo-1,2,3,5-tetrahydro-pteridin-4,6-dion |
| EINECS 230-180-8 |
| 1,2,3,5-Tetrahydro-7-methyl-2-thioxopteridin-4,6-dione |
| 7-methyl-2-thioxo-1,2,3,5-tetrahydro-pteridine-4,6-dione |