4-[2,4-diamino-6-(4-oxo-1-cyclohexa-2,5-dienylidene)-5,8-dihydropteridin-7-ylidene]cyclohexa-2,5-dien-1-one structure
|
Common Name | 4-[2,4-diamino-6-(4-oxo-1-cyclohexa-2,5-dienylidene)-5,8-dihydropteridin-7-ylidene]cyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 6967-77-7 | Molecular Weight | 346.34300 | |
| Density | 1.544g/cm3 | Boiling Point | 537.5ºC at 760 mmHg | |
| Molecular Formula | C18H14N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.9ºC | |
| Name | 4-[2,4-diamino-7-(4-oxocyclohexa-2,5-dien-1-ylidene)-5,8-dihydropteridin-6-ylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.544g/cm3 |
|---|---|
| Boiling Point | 537.5ºC at 760 mmHg |
| Molecular Formula | C18H14N6O2 |
| Molecular Weight | 346.34300 |
| Flash Point | 278.9ºC |
| Exact Mass | 346.11800 |
| PSA | 144.06000 |
| LogP | 3.49180 |
| Index of Refraction | 1.784 |
| InChIKey | OQWMHOAPOCKKHC-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c2nc(-c3ccc(O)cc3)c(-c3ccc(O)cc3)nc2n1 |
|
~%
4-[2,4-diamino-... CAS#:6967-77-7 |
| Literature: Cain et al. Journal of the American Chemical Society, 1949 , vol. 71, p. 892,893,895 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(2,4-diamino-7-(4-hydroxyphenyl)pteridin-6-yl)phenol |
| 6,7-bis(4-hydroxyphenyl)-pteridine-2,4-diamine |
| 6,7-Bis-(4-hydroxy-phenyl)-pteridin-2,4-diyldiamin |
| 6,7-bis-(4-hydroxy-phenyl)-pteridine-2,4-diyldiamine |
| diaminopteridine derivative,20 |