Benzene,1-bromo-2,4-dimethyl-3,5-dinitro- structure
|
Common Name | Benzene,1-bromo-2,4-dimethyl-3,5-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 6967-81-3 | Molecular Weight | 275.05600 | |
| Density | 1.699g/cm3 | Boiling Point | 335.9ºC at 760 mmHg | |
| Molecular Formula | C8H7BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.9ºC | |
| Name | 1-bromo-2,4-dimethyl-3,5-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.699g/cm3 |
|---|---|
| Boiling Point | 335.9ºC at 760 mmHg |
| Molecular Formula | C8H7BrN2O4 |
| Molecular Weight | 275.05600 |
| Flash Point | 156.9ºC |
| Exact Mass | 273.95900 |
| PSA | 91.64000 |
| LogP | 3.92870 |
| Index of Refraction | 1.617 |
| InChIKey | IAXDCFGUXQRIBP-UHFFFAOYSA-N |
| SMILES | Cc1c(Br)cc([N+](=O)[O-])c(C)c1[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
|
~%
Benzene,1-bromo... CAS#:6967-81-3 |
| Literature: Lellmann; Just Chemische Berichte, 1891 , vol. 24, p. 2101 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Brom-2,4-dimethyl-3,5-dinitro-benzol |
| Benzene,1-bromo-2,4-dimethyl-3,5-dinitro |
| 1-bromo-2,4-dimethyl-3,5-dinitro-benzene |