1H-Pyrazole,4,5-dihydro-3-(3-nitrophenyl)-1,5-diphenyl- structure
|
Common Name | 1H-Pyrazole,4,5-dihydro-3-(3-nitrophenyl)-1,5-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 6969-05-7 | Molecular Weight | 343.37900 | |
| Density | 1.23g/cm3 | Boiling Point | 514.4ºC at 760 mmHg | |
| Molecular Formula | C21H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.9ºC | |
| Name | 5-(3-nitrophenyl)-2,3-diphenyl-3,4-dihydropyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 514.4ºC at 760 mmHg |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.37900 |
| Flash Point | 264.9ºC |
| Exact Mass | 343.13200 |
| PSA | 61.42000 |
| LogP | 4.97430 |
| Index of Refraction | 1.655 |
| InChIKey | FETZEIYXNALZIL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C2=NN(c3ccccc3)C(c3ccccc3)C2)c1 |
|
~%
1H-Pyrazole,4,5... CAS#:6969-05-7 |
| Literature: Raiford; Peterson Journal of Organic Chemistry, 1936 , vol. 1, p. 544,550 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(3-nitrophenyl)-1,5-diphenyl-4,5-dihydro-1h-pyrazole |