Benzenamine,N,N-bis[[(4-chlorophenyl)thio]methyl]-4-methyl- structure
|
Common Name | Benzenamine,N,N-bis[[(4-chlorophenyl)thio]methyl]-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6969-13-7 | Molecular Weight | 420.41800 | |
| Density | 1.33g/cm3 | Boiling Point | 551.3ºC at 760mmHg | |
| Molecular Formula | C21H19Cl2NS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.2ºC | |
| Name | N,N-bis[(4-chlorophenyl)sulfanylmethyl]-4-methylaniline |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 551.3ºC at 760mmHg |
| Molecular Formula | C21H19Cl2NS2 |
| Molecular Weight | 420.41800 |
| Flash Point | 287.2ºC |
| Exact Mass | 419.03400 |
| PSA | 53.84000 |
| LogP | 7.60780 |
| Index of Refraction | 1.685 |
| InChIKey | FVPONDWGZCSNHX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(CSc2ccc(Cl)cc2)CSc2ccc(Cl)cc2)cc1 |
|
~%
Benzenamine,N,N... CAS#:6969-13-7 |
| Literature: Grillot; Schaffrath Journal of Organic Chemistry, 1959 , vol. 24, p. 1035,1036 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |