Pyridine,2,4-bis(trichloromethyl)- structure
|
Common Name | Pyridine,2,4-bis(trichloromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 6969-52-4 | Molecular Weight | 313.82300 | |
| Density | 1.693g/cm3 | Boiling Point | 326.1ºC at 760 mmHg | |
| Molecular Formula | C7H3Cl6N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.9ºC | |
| Name | 2,4-bis(trichloromethyl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.693g/cm3 |
|---|---|
| Boiling Point | 326.1ºC at 760 mmHg |
| Molecular Formula | C7H3Cl6N |
| Molecular Weight | 313.82300 |
| Flash Point | 180.9ºC |
| Exact Mass | 310.84000 |
| PSA | 12.89000 |
| LogP | 4.73500 |
| Index of Refraction | 1.588 |
| InChIKey | AWCIKBIGEVDMCI-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)c1ccnc(C(Cl)(Cl)Cl)c1 |
|
~%
Pyridine,2,4-bi... CAS#:6969-52-4 |
| Literature: McBee et al. Industrial and Engineering Chemistry, 1947 , vol. 39, p. 389 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4-Bis-trichlormethyl-pyridin |
| 2,4-bis-trichloromethyl-pyridine |