Benzene,1,1'-(1-methylethylidene)bis[3,4-dimethyl- structure
|
Common Name | Benzene,1,1'-(1-methylethylidene)bis[3,4-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 6970-01-0 | Molecular Weight | 252.39400 | |
| Density | 0.942g/cm3 | Boiling Point | 354.1ºC at 760 mmHg | |
| Molecular Formula | C19H24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.9ºC | |
| Name | 4-[2-(3,4-dimethylphenyl)propan-2-yl]-1,2-dimethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.942g/cm3 |
|---|---|
| Boiling Point | 354.1ºC at 760 mmHg |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.39400 |
| Flash Point | 179.9ºC |
| Exact Mass | 252.18800 |
| LogP | 5.24610 |
| Index of Refraction | 1.537 |
| InChIKey | BGTZYQSCNQIZER-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)(C)c2ccc(C)c(C)c2)cc1C |
| HS Code | 2902909090 |
|---|
|
~%
Benzene,1,1'-(1... CAS#:6970-01-0 |
| Literature: Du Pont de Nemours and Co. Patent: US2712543 , 1954 ; |
|
~%
Benzene,1,1'-(1... CAS#:6970-01-0 |
| Literature: Goudet; Schenker Helvetica Chimica Acta, 1927 , vol. 10, p. 135 |
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| 2,2-bis-(3,4-dimethyl-phenyl)-propane |
| Benzene,1,1'-(1-methylethylidene)bis[3,4-dimethyl |
| 2,2-BIS(3,4-XYLYL)PROPANE |
| Propane,2,2-bis(3,4-xylyl) |