Benzene,2-chloro-4-(1,1-dimethylethyl)-1,3,5-trinitro-
Modify Date: 2025-09-13 17:01:09
Benzene,2-chloro-4-(1,1-dimethylethyl)-1,3,5-trinitro- structure
|
Common Name | Benzene,2-chloro-4-(1,1-dimethylethyl)-1,3,5-trinitro- | ||
|---|---|---|---|---|
| CAS Number | 6971-77-3 | Molecular Weight | 303.65600 | |
| Density | 1.491g/cm3 | Boiling Point | 386.5ºC at 760mmHg | |
| Molecular Formula | C10H10ClN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.5ºC | |
| Name | 2-tert-butyl-4-chloro-1,3,5-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.491g/cm3 |
|---|---|
| Boiling Point | 386.5ºC at 760mmHg |
| Molecular Formula | C10H10ClN3O6 |
| Molecular Weight | 303.65600 |
| Flash Point | 187.5ºC |
| Exact Mass | 303.02600 |
| PSA | 137.46000 |
| LogP | 4.93170 |
| Index of Refraction | 1.594 |
| InChIKey | MPUMCCYZSQBTQW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1c([N+](=O)[O-])cc([N+](=O)[O-])c(Cl)c1[N+](=O)[O-] |
|
~%
Benzene,2-chlor... CAS#:6971-77-3 |
| Literature: Caddy,D.E. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1972 , p. 1807 - 1811 |
|
~%
Benzene,2-chlor... CAS#:6971-77-3 |
| Literature: Caddy,D.E. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1972 , p. 1807 - 1811 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Chlor-3-t-butyl-2,4,6-trinitrobenzol |