ethyl N-(benzhydrylideneamino)carbamate structure
|
Common Name | ethyl N-(benzhydrylideneamino)carbamate | ||
|---|---|---|---|---|
| CAS Number | 6972-01-6 | Molecular Weight | 268.31000 | |
| Density | 1.09g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-(benzhydrylideneamino)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.31000 |
| Exact Mass | 268.12100 |
| PSA | 50.69000 |
| LogP | 3.57600 |
| Index of Refraction | 1.559 |
| InChIKey | VLCNWYFZEIJXGW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NN=C(c1ccccc1)c1ccccc1 |
|
~58%
ethyl N-(benzhy... CAS#:6972-01-6 |
| Literature: Nair, Vijay; Mathew, Smitha C.; Biju, Akkattu T.; Suresh, Eringathodi Synthesis, 2008 , # 7 p. 1078 - 1084 |
|
~13%
ethyl N-(benzhy... CAS#:6972-01-6 |
| Literature: Matsushita, Kimihito; Okamoto, Chieko; Yoshimoto, Mayumi; Harada, Kenichi; Kubo, Miwa; Fukuyama, Yoshiyasu; Hioki, Hideaki Journal of Combinatorial Chemistry, 2010 , vol. 12, # 3 p. 311 - 314 |
| ethyl 2-(diphenylmethylidene)hydrazinecarboxylate |
| Benzophenon-carbethoxyhydrazon |
| benzhydrylidene-carbazic acid ethyl ester |
| Benzhydryliden-carbazidsaeure-aethylester |
| ethyl 2-(diphenylmethylene)hydrazinecarboxylate |