6-[(3,4-dichlorophenyl)amino]-1H-pyrimidine-2,4-dione structure
|
Common Name | 6-[(3,4-dichlorophenyl)amino]-1H-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 6972-74-3 | Molecular Weight | 272.08700 | |
| Density | 1.585g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H7Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(3,4-dichloroanilino)-1H-pyrimidine-2,4-dione |
|---|
| Density | 1.585g/cm3 |
|---|---|
| Molecular Formula | C10H7Cl2N3O2 |
| Molecular Weight | 272.08700 |
| Exact Mass | 270.99200 |
| PSA | 77.75000 |
| LogP | 2.18660 |
| Index of Refraction | 1.668 |
| InChIKey | LIRVMDIXHXAYMS-UHFFFAOYSA-N |
| SMILES | O=c1cc(Nc2ccc(Cl)c(Cl)c2)[nH]c(=O)[nH]1 |
|
~44%
6-[(3,4-dichlor... CAS#:6972-74-3 |
| Literature: Wright; Brown Journal of Medicinal Chemistry, 1980 , vol. 23, # 1 p. 34 - 38 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |