ethyl 6-hydroxyquinoline-3-carboxylate structure
|
Common Name | ethyl 6-hydroxyquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6972-86-7 | Molecular Weight | 217.22100 | |
| Density | 1.28g/cm3 | Boiling Point | 370.4ºC at 760 mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.8ºC | |
| Name | ethyl 6-hydroxyquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 370.4ºC at 760 mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22100 |
| Flash Point | 177.8ºC |
| Exact Mass | 217.07400 |
| PSA | 59.42000 |
| LogP | 2.11710 |
| Index of Refraction | 1.631 |
| InChIKey | PPAXVLCDNYNJJK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2ccc(O)cc2c1 |
| HS Code | 2933499090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-hydroxyquinoline-3-carboxylic acid ethyl ester |