1-benzhydrylpyrimidine-2,4-dione structure
|
Common Name | 1-benzhydrylpyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 697237-44-8 | Molecular Weight | 278.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzhydrylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H14N2O2 |
|---|---|
| Molecular Weight | 278.30500 |
| Exact Mass | 278.10600 |
| PSA | 55.12000 |
| LogP | 2.58660 |
| InChIKey | XKYBWMWINUDREB-UHFFFAOYSA-N |
| SMILES | O=c1ccn(C(c2ccccc2)c2ccccc2)c(=O)[nH]1 |
|
~82%
1-benzhydrylpyr... CAS#:697237-44-8 |
| Literature: Wu, Fan; Buhendwa, Musole G.; Weaver, Donald F. Journal of Organic Chemistry, 2004 , vol. 69, # 26 p. 9307 - 9309 |
|
~70%
1-benzhydrylpyr... CAS#:697237-44-8 |
| Literature: Malik, Vaishali; Singh, Palwinder; Kumar, Subodh Tetrahedron, 2005 , vol. 61, # 16 p. 4009 - 4014 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: Cell survival assay for modulators of telomere damage signalling
Source: 15378
Target: N/A
External Id: TELO_02
|
| 1-(diphenylmethyl)uracil |
| 2,4(1H,3H)-Pyrimidinedione,1-(diphenylmethyl) |
| 1-(diphenylmethyl)-1,3-dihydropyrimidine-2,4-dione |
| 1-benzhydryl-1H-pyrimidine-2,4-dione |