10,13-dimethyldocos-11-yne-10,13-diol structure
|
Common Name | 10,13-dimethyldocos-11-yne-10,13-diol | ||
|---|---|---|---|---|
| CAS Number | 69727-13-5 | Molecular Weight | 366.62100 | |
| Density | 0.909g/cm3 | Boiling Point | 327.8ºC at 760 mmHg | |
| Molecular Formula | C24H46O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.4ºC | |
| Name | 10,13-dimethyldocos-11-yne-10,13-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.909g/cm3 |
|---|---|
| Boiling Point | 327.8ºC at 760 mmHg |
| Molecular Formula | C24H46O2 |
| Molecular Weight | 366.62100 |
| Flash Point | 110.4ºC |
| Exact Mass | 366.35000 |
| PSA | 40.46000 |
| LogP | 6.77320 |
| Index of Refraction | 1.478 |
| InChIKey | SVJREAUWQPERAY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(C)(O)C#CC(C)(O)CCCCCCCCC |
|
~%
10,13-dimethyld... CAS#:69727-13-5 |
| Literature: Locquin; Sung Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1922 , vol. 174, p. 1429 |
|
~%
10,13-dimethyld... CAS#:69727-13-5 |
| Literature: Petrow; Karlik Zhurnal Obshchei Khimii, 1941 , vol. 11, p. 1102 Chem.Abstr., 1943 , p. 4049 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 10,13-dimethyl-docos-11-yne-10,13-diol |
| 10,13-Dimethyl-docos-11-in-10,13-diol |
| 10,13-Dimethyl-11-docosyne-10,13-diol |