Benzenamine,N-methylene-4-nitro- structure
|
Common Name | Benzenamine,N-methylene-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 6973-12-2 | Molecular Weight | 150.13500 | |
| Density | 1.19g/cm3 | Boiling Point | 292ºC at 760 mmHg | |
| Molecular Formula | C7H6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.4ºC | |
| Name | N-(4-nitrophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 292ºC at 760 mmHg |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.13500 |
| Flash Point | 130.4ºC |
| Exact Mass | 150.04300 |
| PSA | 58.18000 |
| LogP | 2.45010 |
| Index of Refraction | 1.561 |
| InChIKey | HXHIWKCPLNZQQD-UHFFFAOYSA-N |
| SMILES | C=Nc1ccc([N+](=O)[O-])cc1 |
|
~%
Benzenamine,N-m... CAS#:6973-12-2 |
| Literature: Butler, Richard N.; O'Shea, Donal F. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1994 , # 19 p. 2797 - 2800 |
| 1-Nitro-4-isocyan-benzol |
| n-methylidene-4-nitroaniline |
| Benzenamine,N-methylene-4-nitro |