Pyrazolo[1,5-a]pyridine-3,4-dicarbonitrile,2-amino-5-hydroxy-7-methyl- structure
|
Common Name | Pyrazolo[1,5-a]pyridine-3,4-dicarbonitrile,2-amino-5-hydroxy-7-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6974-82-9 | Molecular Weight | 213.19500 | |
| Density | 1.53g/cm3 | Boiling Point | 324.6ºC at 760 mmHg | |
| Molecular Formula | C10H7N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.1ºC | |
| Name | 2-amino-7-methyl-5-oxo-1H-pyrazolo[1,5-a]pyridine-3,4-dicarbonitrile |
|---|
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 324.6ºC at 760 mmHg |
| Molecular Formula | C10H7N5O |
| Molecular Weight | 213.19500 |
| Flash Point | 150.1ºC |
| Exact Mass | 213.06500 |
| PSA | 111.13000 |
| LogP | 1.25506 |
| Index of Refraction | 1.708 |
| InChIKey | SBVKBCDCWWODKH-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)c(C#N)c2c(C#N)c(N)[nH]n12 |
|
~%
Pyrazolo[1,5-a]... CAS#:6974-82-9 |
| Literature: Taylor; Hartke Journal of the American Chemical Society, 1959 , vol. 81, p. 2452,2455 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |