2-(2,3-dimethylphenyl)-3-methyl-butanoic acid structure
|
Common Name | 2-(2,3-dimethylphenyl)-3-methyl-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 6975-04-8 | Molecular Weight | 206.28100 | |
| Density | 1.031g/cm3 | Boiling Point | 323.9ºC at 760 mmHg | |
| Molecular Formula | C13H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | 2-(2,3-dimethylphenyl)-3-methylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.031g/cm3 |
|---|---|
| Boiling Point | 323.9ºC at 760 mmHg |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28100 |
| Flash Point | 220.9ºC |
| Exact Mass | 206.13100 |
| PSA | 37.30000 |
| LogP | 3.12760 |
| Index of Refraction | 1.52 |
| InChIKey | JWGATTNQHJYNSU-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(C(=O)O)C(C)C)c1C |
|
~%
2-(2,3-dimethyl... CAS#:6975-04-8 |
| Literature: Herz; Cleare Journal of the American Chemical Society, 1955 , vol. 77, p. 2318 |
|
~%
2-(2,3-dimethyl... CAS#:6975-04-8 |
| Literature: Herz; Cleare Journal of the American Chemical Society, 1955 , vol. 77, p. 2318 |
|
~%
2-(2,3-dimethyl... CAS#:6975-04-8 |
| Literature: Herz; Cleare Journal of the American Chemical Society, 1955 , vol. 77, p. 2318 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-(2,3-Dimethyl-phenyl)-3-methyl-buttersaeure |
| 2-(2,3-dimethyl-phenyl)-3-methyl-butyric acid |