2-(2,5-dimethylphenyl)-3-methyl-butanamide structure
|
Common Name | 2-(2,5-dimethylphenyl)-3-methyl-butanamide | ||
|---|---|---|---|---|
| CAS Number | 6975-06-0 | Molecular Weight | 205.29600 | |
| Density | 0.995g/cm3 | Boiling Point | 355.1ºC at 760 mmHg | |
| Molecular Formula | C13H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.5ºC | |
| Name | 2-(2,5-dimethylphenyl)-3-methylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.995g/cm3 |
|---|---|
| Boiling Point | 355.1ºC at 760 mmHg |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.29600 |
| Flash Point | 168.5ºC |
| Exact Mass | 205.14700 |
| PSA | 43.09000 |
| LogP | 3.22860 |
| Index of Refraction | 1.521 |
| InChIKey | IPZQTAGUPUCIBQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(C(C(N)=O)C(C)C)c1 |
|
~%
2-(2,5-dimethyl... CAS#:6975-06-0 |
| Literature: Herz Journal of the American Chemical Society, 1953 , vol. 75, p. 73,77 |
|
~%
2-(2,5-dimethyl... CAS#:6975-06-0 |
| Literature: Herz Journal of the American Chemical Society, 1953 , vol. 75, p. 73,77 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(2,5-Dimethyl-phenyl)-3-methyl-buttersaeure-amid |
| 2-(2,5-dimethyl-phenyl)-3-methyl-butyric acid amide |