6,6-dimethyl-1,5-diphenyl-hept-1-en-3-one structure
|
Common Name | 6,6-dimethyl-1,5-diphenyl-hept-1-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 6975-07-1 | Molecular Weight | 292.41500 | |
| Density | 1.015g/cm3 | Boiling Point | 427.9ºC at 760 mmHg | |
| Molecular Formula | C21H24O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.8ºC | |
| Name | (Z)-6,6-dimethyl-1,5-diphenylhept-1-en-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.015g/cm3 |
|---|---|
| Boiling Point | 427.9ºC at 760 mmHg |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.41500 |
| Flash Point | 164.8ºC |
| Exact Mass | 292.18300 |
| PSA | 17.07000 |
| LogP | 5.48890 |
| Index of Refraction | 1.569 |
| InChIKey | FZRMCJWOUKRDIU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(CC(=O)C=Cc1ccccc1)c1ccccc1 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 6,6-Dimethyl-1,5-diphenyl-hepten-(1)-on-(3) |
| 1,2-Oxathiane,6,6-dimethyl-,2-oxide |
| 6,6-Dimethyl-1,2-oxathian-2-oxid |