Propanoic acid,3,3'-thiobis-, 1,1'-dibutyl ester structure
|
Common Name | Propanoic acid,3,3'-thiobis-, 1,1'-dibutyl ester | ||
|---|---|---|---|---|
| CAS Number | 6975-31-1 | Molecular Weight | 290.41900 | |
| Density | 1.035g/cm3 | Boiling Point | 377.8ºC at 760 mmHg | |
| Molecular Formula | C14H26O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.6ºC | |
| Name | butyl 3-(3-butoxy-3-oxopropyl)sulfanylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.035g/cm3 |
|---|---|
| Boiling Point | 377.8ºC at 760 mmHg |
| Molecular Formula | C14H26O4S |
| Molecular Weight | 290.41900 |
| Flash Point | 169.6ºC |
| Exact Mass | 290.15500 |
| PSA | 77.90000 |
| LogP | 3.18640 |
| Index of Refraction | 1.471 |
| InChIKey | HPVVIIKTKWMIGP-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CCSCCC(=O)OCCCC |
|
~78%
Propanoic acid,... CAS#:6975-31-1 |
| Literature: Kumar, Anil; Tilak, B. D. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 880 - 882 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Dibutyl thiodipropionate |
| Dibutyl 3,3'-thiodipropionate |
| Propanoic acid,3,3'-thiobis-,dibutyl ester |
| dibutyl 3,3'-sulfanediyldipropanoate |
| 4-thia-heptanedioic acid dibutyl ester |
| Thiodipropionsaeure-n-butylester |
| 4-Thia-heptandisaeure-dibutylester |
| Bis-(2-butoxycarbonyl-aethyl)-sulfid |
| Dibutyl 3,3'-thiobispropionate |
| EINECS 230-231-4 |