9H-Purin-6-amine,2-(3-pyridinyl) structure
|
Common Name | 9H-Purin-6-amine,2-(3-pyridinyl) | ||
|---|---|---|---|---|
| CAS Number | 6975-45-7 | Molecular Weight | 212.21100 | |
| Density | 1.65g/cm3 | Boiling Point | 417.8ºC at 760mmHg | |
| Molecular Formula | C10H8N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.4ºC | |
| Name | 2-pyridin-3-yl-7H-purin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 417.8ºC at 760mmHg |
| Molecular Formula | C10H8N6 |
| Molecular Weight | 212.21100 |
| Flash Point | 206.4ºC |
| Exact Mass | 212.08100 |
| PSA | 93.37000 |
| LogP | 1.57830 |
| Index of Refraction | 1.866 |
| InChIKey | VLLMIIGGVPVMJI-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2cccnc2)nc2nc[nH]c12 |
|
~%
9H-Purin-6-amin... CAS#:6975-45-7 |
| Literature: Taylor; Barton Journal of the American Chemical Society, 1959 , vol. 81, p. 2448,2451 |
|
~%
9H-Purin-6-amin... CAS#:6975-45-7 |
| Literature: Taylor; Barton Journal of the American Chemical Society, 1959 , vol. 81, p. 2448,2451 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| s07-0168 |