1,2-Propanediol,1-[1,1'-biphenyl]-4-yl-1-methoxy-2-methyl-, 1-(3,5-dinitrobenzoate) structure
|
Common Name | 1,2-Propanediol,1-[1,1'-biphenyl]-4-yl-1-methoxy-2-methyl-, 1-(3,5-dinitrobenzoate) | ||
|---|---|---|---|---|
| CAS Number | 6976-21-2 | Molecular Weight | 466.44000 | |
| Density | 1.341g/cm3 | Boiling Point | 659.7ºC at 760 mmHg | |
| Molecular Formula | C24H22N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 352.8ºC | |
| Name | [2-hydroxy-1-methoxy-2-methyl-1-(4-phenylphenyl)propyl] 3,5-dinitrobenzoate |
|---|
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 659.7ºC at 760 mmHg |
| Molecular Formula | C24H22N2O8 |
| Molecular Weight | 466.44000 |
| Flash Point | 352.8ºC |
| Exact Mass | 466.13800 |
| PSA | 147.40000 |
| LogP | 5.64350 |
| Index of Refraction | 1.616 |
| InChIKey | QCXAQAKELJMHKQ-UHFFFAOYSA-N |
| SMILES | COC(OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)(c1ccc(-c2ccccc2)cc1)C(C)(C)O |
|
~%
1,2-Propanediol... CAS#:6976-21-2 |
| Literature: Stevens; Dykstra Journal of the American Chemical Society, 1953 , vol. 75, p. 5975,5977 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |