.beta.-Alanine, N-(3-ethoxy-3-oxopropyl)-N-nitroso-, ethyl ester (9CI) structure
|
Common Name | .beta.-Alanine, N-(3-ethoxy-3-oxopropyl)-N-nitroso-, ethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6976-38-1 | Molecular Weight | 246.26000 | |
| Density | 1.16g/cm3 | Boiling Point | 377.6ºC at 760 mmHg | |
| Molecular Formula | C10H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.2ºC | |
| Name | ethyl 3-[(3-ethoxy-3-oxopropyl)-nitrosoamino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 377.6ºC at 760 mmHg |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26000 |
| Flash Point | 182.2ºC |
| Exact Mass | 246.12200 |
| PSA | 85.27000 |
| LogP | 0.87620 |
| Index of Refraction | 1.482 |
| InChIKey | FYKNBBJIVXDACD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCN(CCC(=O)OCC)N=O |
|
~%
.beta.-Alanine,... CAS#:6976-38-1 |
| Literature: McElvain; Stork Journal of the American Chemical Society, 1946 , vol. 68, p. 1049,1052 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3'-Nitrosoimino-di-propionsaeure-diaethylester |
| 3,3'-nitrosoimino-di-propionic acid diethyl ester |