1,3-Benzodioxole,5-bromo-6-[2-bromo-1-(1-methylethoxy)propyl]- structure
|
Common Name | 1,3-Benzodioxole,5-bromo-6-[2-bromo-1-(1-methylethoxy)propyl]- | ||
|---|---|---|---|---|
| CAS Number | 6976-62-1 | Molecular Weight | 380.07200 | |
| Density | 1.605g/cm3 | Boiling Point | 381ºC at 760 mmHg | |
| Molecular Formula | C13H16Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.4ºC | |
| Name | 5-bromo-6-(2-bromo-1-propan-2-yloxypropyl)-1,3-benzodioxole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.605g/cm3 |
|---|---|
| Boiling Point | 381ºC at 760 mmHg |
| Molecular Formula | C13H16Br2O3 |
| Molecular Weight | 380.07200 |
| Flash Point | 156.4ºC |
| Exact Mass | 377.94700 |
| PSA | 27.69000 |
| LogP | 4.42730 |
| Index of Refraction | 1.569 |
| InChIKey | KBAJNAKXIYPNNE-UHFFFAOYSA-N |
| SMILES | CC(C)OC(c1cc2c(cc1Br)OCO2)C(C)Br |
|
~%
1,3-Benzodioxol... CAS#:6976-62-1 |
| Literature: Alexander et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 1504,1507 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Brom-6-(2-brom-1-isopropoxy-propyl)-benzo[1,3]dioxol |
| 5-bromo-6-[2-bromo-1-(propan-2-yloxy)propyl]-1,3-benzodioxole |
| 5-bromo-6-(2-bromo-1-isopropoxy-propyl)-benzo[1,3]dioxole |