6-bromo-5-[2-bromo-1-(2-methoxyethoxy)propyl]benzo[1,3]dioxole structure
|
Common Name | 6-bromo-5-[2-bromo-1-(2-methoxyethoxy)propyl]benzo[1,3]dioxole | ||
|---|---|---|---|---|
| CAS Number | 6976-66-5 | Molecular Weight | 396.07200 | |
| Density | 1.632g/cm3 | Boiling Point | 406.9ºC at 760 mmHg | |
| Molecular Formula | C13H16Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.9ºC | |
| Name | 5-bromo-6-[2-bromo-1-(2-methoxyethoxy)propyl]-1,3-benzodioxole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.632g/cm3 |
|---|---|
| Boiling Point | 406.9ºC at 760 mmHg |
| Molecular Formula | C13H16Br2O4 |
| Molecular Weight | 396.07200 |
| Flash Point | 167.9ºC |
| Exact Mass | 393.94200 |
| PSA | 36.92000 |
| LogP | 3.66530 |
| Index of Refraction | 1.567 |
| InChIKey | ZYDCBKYLXHYGPK-UHFFFAOYSA-N |
| SMILES | COCCOC(c1cc2c(cc1Br)OCO2)C(C)Br |
|
~%
6-bromo-5-[2-br... CAS#:6976-66-5 |
| Literature: Alexander et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 1504,1507 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-bromo-1-(6-bromo-benzo[1,3]dioxol-5-yl)-1-(2-methoxy-ethoxy)-propane |
| 2-Brom-1-(6-brom-benzo[1,3]dioxol-5-yl)-1-(2-methoxy-aethoxy)-propan |