2-Propenamide,3-[[(butylamino)carbonyl]amino]-2-cyano- structure
|
Common Name | 2-Propenamide,3-[[(butylamino)carbonyl]amino]-2-cyano- | ||
|---|---|---|---|---|
| CAS Number | 6976-80-3 | Molecular Weight | 210.23300 | |
| Density | 1.171g/cm3 | Boiling Point | 391.2ºC at 760 mmHg | |
| Molecular Formula | C9H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.4ºC | |
| Name | 3-(butylcarbamoylamino)-2-cyanoprop-2-enamide |
|---|
| Density | 1.171g/cm3 |
|---|---|
| Boiling Point | 391.2ºC at 760 mmHg |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.23300 |
| Flash Point | 190.4ºC |
| Exact Mass | 210.11200 |
| PSA | 108.01000 |
| LogP | 1.46058 |
| Index of Refraction | 1.517 |
| InChIKey | VPJUVOFFJJNPNO-SREVYHEPSA-N |
| SMILES | CCCCNC(=O)NC=C(C#N)C(N)=O |
|
~%
2-Propenamide,3... CAS#:6976-80-3 |
| Literature: Whitehead; Traverso Journal of the American Chemical Society, 1955 , vol. 77, p. 5872,5875 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |