methylpiperidino)propyl ester, hydrochloride structure
|
Common Name | methylpiperidino)propyl ester, hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 69766-24-1 | Molecular Weight | 403.94200 | |
| Density | N/A | Boiling Point | 513.5ºC at 760 mmHg | |
| Molecular Formula | C23H30ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.3ºC | |
| Name | 3-(2-methylpiperidin-1-ium-1-yl)propyl 4-(4-methoxyphenyl)benzoate,chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 513.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H30ClNO3 |
| Molecular Weight | 403.94200 |
| Flash Point | 264.3ºC |
| Exact Mass | 403.19100 |
| PSA | 38.77000 |
| LogP | 5.52340 |
| InChIKey | TZYRJXZWCDZCNG-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc(C(=O)OCCC[NH+]3CCCCC3C)cc2)cc1.[Cl-] |
|
~%
methylpiperidin... CAS#:69766-24-1 |
| Literature: McElvain; Carney Journal of the American Chemical Society, 1946 , vol. 68, p. 2592,2599 |
|
~%
methylpiperidin... CAS#:69766-24-1 |
| Literature: McElvain; Carney Journal of the American Chemical Society, 1946 , vol. 68, p. 2592,2599 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 4'-Methoxy-biphenyl-4-carbonsaeure-[3-(2-methyl-piperidino)-propylester],Hydrochlorid |
| 4-Biphenylcarboxylic acid,4'-methoxy-,3-(2-methylpiperidino)propyl ester,hydrochloride |
| 3-(2-methylpiperidin-1-ium-1-yl)propyl 4-(4-methoxyphenyl)benzoate chloride |
| 4'-Methoxy-4-biphenylcarboxylic acid,3-(2-methylpiperidino)propyl ester,hydrochloride |
| 4'-methoxy-biphenyl-4-carboxylic acid-[3-(2-methyl-piperidino)-propylester],hydrochloride |