Pyochelin
Modify Date: 2026-06-29 22:36:15
Pyochelin structure
|
Common Name | Pyochelin | ||
|---|---|---|---|---|
| CAS Number | 69772-54-9 | Molecular Weight | 324.41800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | pyochelin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16N2O3S2 |
|---|---|
| Molecular Weight | 324.41800 |
| Exact Mass | 324.06000 |
| PSA | 123.73000 |
| LogP | 1.08560 |
| InChIKey | NYBZAGXTZXPYND-GDVCOKDOSA-N |
| SMILES | CN1C(C(=O)O)CSC1C1CSC(c2ccccc2O)=N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of pyochelin? |
| A: LogP of pyochelin is 1.08560. |
| Q: What is the molecular formula of pyochelin? |
| A: Molecular formula of pyochelin is C14H16N2O3S2. |
| Q: What is the English name of pyochelin? |
| A: The English name of pyochelin is pyochelin. |
| Q: What is the CAS number of pyochelin? |
| A: CAS number of pyochelin is 69772-54-9. |
| Q: What is the polar surface area (PSA) of pyochelin? |
| A: Polar surface area (PSA) of pyochelin is 123.73000. |
| Q: What is the SMILES notation of pyochelin? |
| A: SMILES notation of pyochelin is CN1C(C(=O)O)CSC1C1CSC(c2ccccc2O)=N1. |
| Q: What is the molecular weight of pyochelin? |
| A: Molecular weight of pyochelin is 324.41800. |
| Q: What is the Chinese name of 69772-54-9? |
| A: Chinese name of 69772-54-9 is 69772-54-9. |
| Q: What is the InChIKey of pyochelin? |
| A: InChIKey of pyochelin is NYBZAGXTZXPYND-GDVCOKDOSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |