[2-[(4-oxopiperidin-1-yl)methyl]phenyl]boronic acid structure
|
Common Name | [2-[(4-oxopiperidin-1-yl)methyl]phenyl]boronic acid | ||
|---|---|---|---|---|
| CAS Number | 697739-42-7 | Molecular Weight | 233.07100 | |
| Density | 1.22g/cm3 | Boiling Point | 445.9ºC at 760 mmHg | |
| Molecular Formula | C12H16BNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.5ºC | |
| Name | [2-[(4-oxopiperidin-1-yl)methyl]phenyl]boronic acid |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 445.9ºC at 760 mmHg |
| Molecular Formula | C12H16BNO3 |
| Molecular Weight | 233.07100 |
| Flash Point | 223.5ºC |
| Exact Mass | 233.12200 |
| PSA | 60.77000 |
| Index of Refraction | 1.577 |
| InChIKey | FIUCWBGMMCBNJU-UHFFFAOYSA-N |
| SMILES | O=C1CCN(Cc2ccccc2B(O)O)CC1 |
| HS Code | 2933399090 |
|---|
|
~73%
[2-[(4-oxopiper... CAS#:697739-42-7 |
| Literature: Merck Sharp and Dohme Limited Patent: WO2004/46133 A1, 2004 ; Location in patent: Page 43 ; WO 2004/046133 A1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |