Propanoic acid,2-methyl-, 2-[1,1'-biphenyl]-4-yl-2-oxoethyl ester structure
|
Common Name | Propanoic acid,2-methyl-, 2-[1,1'-biphenyl]-4-yl-2-oxoethyl ester | ||
|---|---|---|---|---|
| CAS Number | 69787-81-1 | Molecular Weight | 282.33400 | |
| Density | 1.102g/cm3 | Boiling Point | 415.1ºC at 760mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.4ºC | |
| Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 415.1ºC at 760mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33400 |
| Flash Point | 182.4ºC |
| Exact Mass | 282.12600 |
| PSA | 43.37000 |
| LogP | 3.73550 |
| Index of Refraction | 1.546 |
| InChIKey | RSVQLPPONUWMGZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OCC(=O)c1ccc(-c2ccccc2)cc1 |
|
~%
Propanoic acid,... CAS#:69787-81-1 |
| Literature: Snell; McElvain Journal of the American Chemical Society, 1933 , vol. 55, p. 416,427 View citing articles Show Details Jansen Journal of Biological Chemistry, 1948 , vol. 176, p. 662 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-[1,1'-Biphenyl]-4-yl-2-oxoethyl 2-methylpropanoate |
| p-Phenyl-phenacyl-isobutyrat |
| 1-biphenyl-4-yl-2-isobutyryloxy-ethanone |
| Isobuttersaeure-4-phenyl-phenacylester |
| 4-phenylphenacylisobutyrate |
| 2-(biphenyl-4-yl)-2-oxoethyl 2-methylpropanoate |
| 1-Biphenyl-4-yl-2-isobutyryloxy-aethanon |