N-(1,3-benzothiazol-2-yl)-1-(2-nitrophenyl)methanimine structure
|
Common Name | N-(1,3-benzothiazol-2-yl)-1-(2-nitrophenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 69791-42-0 | Molecular Weight | 283.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(1,3-benzothiazol-2-yl)-1-(2-nitrophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9N3O2S |
|---|---|
| Molecular Weight | 283.30500 |
| Exact Mass | 283.04200 |
| PSA | 99.31000 |
| LogP | 4.47830 |
| InChIKey | JLMNXXYVTWVZDS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1C=Nc1nc2ccccc2s1 |
|
~69%
N-(1,3-benzothi... CAS#:69791-42-0 |
| Literature: Srivastava; Shukla Journal of the Indian Chemical Society, 2008 , vol. 85, # 3 p. 306 - 309 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Benzothiazolamine,N-[(2-nitrophenyl)methylene] |
| benzothiazol-2-yl-(2-nitro-benzylidene)-amine |