3-(1,3-benzothiazol-2-yl)-2-(2-chlorophenyl)-1,3-thiazolidin-4-one structure
|
Common Name | 3-(1,3-benzothiazol-2-yl)-2-(2-chlorophenyl)-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 69791-53-3 | Molecular Weight | 346.85400 | |
| Density | 1.489g/cm3 | Boiling Point | 518.7ºC at 760mmHg | |
| Molecular Formula | C16H11ClN2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.5ºC | |
| Name | 3-(1,3-benzothiazol-2-yl)-2-(2-chlorophenyl)-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.489g/cm3 |
|---|---|
| Boiling Point | 518.7ºC at 760mmHg |
| Molecular Formula | C16H11ClN2OS2 |
| Molecular Weight | 346.85400 |
| Flash Point | 267.5ºC |
| Exact Mass | 346.00000 |
| PSA | 86.74000 |
| LogP | 4.79330 |
| Index of Refraction | 1.738 |
| InChIKey | VUZQOWGNWXNMAL-UHFFFAOYSA-N |
| SMILES | O=C1CSC(c2ccccc2Cl)N1c1nc2ccccc2s1 |
|
~74%
3-(1,3-benzothi... CAS#:69791-53-3 |
| Literature: Srivastava; Shukla Journal of the Indian Chemical Society, 2008 , vol. 85, # 3 p. 306 - 309 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Thiazolidinone,3-(2-benzothiazolyl)-2-(o-chlorophenyl) |
| 3-(2-Benzothiazolyl)-2-(o-chlorophenyl)-4-thiazolidinone |
| 3-benzothiazol-2-yl-2-(2-chloro-phenyl)-thiazolidin-4-one |
| 4-Thiazolidinone,3-(2-benzothiazolyl)-2-(2-chlorophenyl) |