1H-[1,4]Benzoxathiino[2,3-f]indole, 2-(4-methylphenyl)- structure
|
Common Name | 1H-[1,4]Benzoxathiino[2,3-f]indole, 2-(4-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 69793-13-1 | Molecular Weight | 329.41500 | |
| Density | 1.314g/cm3 | Boiling Point | 553.3ºC at 760 mmHg | |
| Molecular Formula | C21H15NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.4ºC | |
| Name | 2-(4-methylphenyl)-1H-[1,4]benzoxathiino[2,3-f]indole |
|---|
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 553.3ºC at 760 mmHg |
| Molecular Formula | C21H15NOS |
| Molecular Weight | 329.41500 |
| Flash Point | 288.4ºC |
| Exact Mass | 329.08700 |
| PSA | 50.32000 |
| LogP | 6.40020 |
| Index of Refraction | 1.735 |
| InChIKey | IGMXIYJSWPFRAD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2cc3cc4c(cc3[nH]2)Sc2ccccc2O4)cc1 |
|
~%
1H-[1,4]Benzoxa... CAS#:69793-13-1 |
| Literature: Coic,J.-P.; Saint-Ruf,G. Journal of Heterocyclic Chemistry, 1978 , vol. 15, p. 1367 - 1371 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |