1(3H)-Isobenzofuranone,4-chloro-7-(3,5- dichloro-2,4-dimethoxy-6-methylphenoxy)-5- methoxy- structure
|
Common Name | 1(3H)-Isobenzofuranone,4-chloro-7-(3,5- dichloro-2,4-dimethoxy-6-methylphenoxy)-5- methoxy- | ||
|---|---|---|---|---|
| CAS Number | 69799-33-3 | Molecular Weight | 433.66700 | |
| Density | 1.441g/cm3 | Boiling Point | 595.3ºC at 760 mmHg | |
| Molecular Formula | C18H15Cl3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.3ºC | |
| Name | 4-chloro-7-(3,5-dichloro-2,4-dimethoxy-6-methylphenoxy)-5-methoxy-3H-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.441g/cm3 |
|---|---|
| Boiling Point | 595.3ºC at 760 mmHg |
| Molecular Formula | C18H15Cl3O6 |
| Molecular Weight | 433.66700 |
| Flash Point | 225.3ºC |
| Exact Mass | 431.99300 |
| PSA | 63.22000 |
| LogP | 5.44370 |
| Index of Refraction | 1.59 |
| InChIKey | OXWGVBMJMQGGEG-UHFFFAOYSA-N |
| SMILES | COc1cc(Oc2c(C)c(Cl)c(OC)c(Cl)c2OC)c2c(c1Cl)COC2=O |
|
~%
1(3H)-Isobenzof... CAS#:69799-33-3 |
| Literature: Sala, Tony; Sargent, Melvyn V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 849 - 854 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| buellolide |