ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate
ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate structure
|
Common Name | ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 69811-33-2 | Molecular Weight | 233.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15N3O2 |
|---|---|
| Molecular Weight | 233.26600 |
| Exact Mass | 233.11600 |
| PSA | 66.21000 |
| LogP | 1.40180 |
| InChIKey | OKHQWADIIMWOOX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=NCC(c2ccccc2)N1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl N-(5-phen... CAS#:69811-33-2 |
| Literature: Weinhardt; Beard; Dvorak; Marx; Patterson; Roszkowski; Schuler; Unger; Wagner; Wallach Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 616 - 627 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,5-dihydro-2-ethoxycarbonylamino-4-phenylimidazole |
| Carbamic acid,(4,5-dihydro-4-phenyl-1H-imidazol-2-yl)-,ethyl ester |
| (4-phenyl-4,5-dihydro-1(3)H-imidazol-2-yl)-carbamic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate? |
| A: SMILES notation of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate is CCOC(=O)NC1=NCC(c2ccccc2)N1. |
| Q: What is the molecular formula of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate? |
| A: Molecular formula of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate is C12H15N3O2. |
| Q: What is the polar surface area (PSA) of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate? |
| A: Polar surface area (PSA) of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate is 66.21000. |
| Q: What is the English name of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate? |
| A: The English name of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate is ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate. |
| Q: What are the upstream materials of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate? |
| A: Related upstream materials(CAS) of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate: 34840-26-1. |
| Q: What English synonyms does ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate have? |
| A: English synonyms of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate: 4,5-dihydro-2-ethoxycarbonylamino-4-phenylimidazole, Carbamic acid,(4,5-dihydro-4-phenyl-1H-imidazol-2-yl)-,ethyl ester, (4-phenyl-4,5-dihydro-1(3)H-imidazol-2-yl)-carbamic acid ethyl ester. |
| Q: What is the Chinese name of 69811-33-2? |
| A: Chinese name of 69811-33-2 is 69811-33-2. |
| Q: What is the InChIKey of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate? |
| A: InChIKey of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate is OKHQWADIIMWOOX-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate? |
| A: Molecular weight of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate is 233.26600. |
| Q: What is the CAS number of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate? |
| A: CAS number of ethyl N-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)carbamate is 69811-33-2. |