1,1,2,3,3,4,4-heptafluoro-4-(1,2,2-trifluoroethenoxy)but-1-ene structure
|
Common Name | 1,1,2,3,3,4,4-heptafluoro-4-(1,2,2-trifluoroethenoxy)but-1-ene | ||
|---|---|---|---|---|
| CAS Number | 69818-05-9 | Molecular Weight | 278.048 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 107.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C6F10O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 24.1±23.2 °C | |
| Name | 1,1,2,3,3,4,4-heptafluoro-4-(1,2,2-trifluoroethenoxy)but-1-ene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 107.1±40.0 °C at 760 mmHg |
| Molecular Formula | C6F10O |
| Molecular Weight | 278.048 |
| Flash Point | 24.1±23.2 °C |
| Exact Mass | 277.978943 |
| PSA | 9.23000 |
| LogP | 6.62 |
| Vapour Pressure | 32.1±0.2 mmHg at 25°C |
| Index of Refraction | 1.299 |
| InChIKey | GHDBATCSDZIYOS-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)OC(F)(F)C(F)(F)C(F)=C(F)F |
|
~%
1,1,2,3,3,4,4-h... CAS#:69818-05-9 |
| Literature: Sullivan,R. Journal of Organic Chemistry, 1969 , vol. 34, # 6 p. 1841 - 1844 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,1,2,3,3,4,4-Heptafluoro-4-[(trifluorovinyl)oxy]-1-butene |
| 1-Butene, 1,1,2,3,3,4,4-heptafluoro-4-[(1,2,2-trifluoroethenyl)oxy]- |
| perfluoro(3-butenylvinylether) |
| 1-Butene,1,1,2,3,3,4,4-heptafluoro-4-[(trifluoroethenyl)oxy] |
| Perfluor-3-oxa-heptadien-(1,6) |
| CF2=CFOCF2CF2CF=CF2 |
| perfluoro(4-vinyloxyl-1-butene) |