5-nitrothiophene-3-sulfonyl chloride structure
|
Common Name | 5-nitrothiophene-3-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 69824-57-3 | Molecular Weight | 227.64600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H2ClNO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-nitrothiophene-3-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H2ClNO4S2 |
|---|---|
| Molecular Weight | 227.64600 |
| Exact Mass | 226.91100 |
| PSA | 116.58000 |
| LogP | 3.18780 |
| InChIKey | FLUCEXVDXIPPFI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Cl)cs1 |
|
~%
5-nitrothiophen... CAS#:69824-57-3 |
| Literature: Lew; Noller Journal of the American Chemical Society, 1950 , vol. 72, p. 5715 |
|
~%
5-nitrothiophen... CAS#:69824-57-3 |
| Literature: Steinkopf; Hoepner Justus Liebigs Annalen der Chemie, 1933 , vol. 501, p. 174,182 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Nitro-thiophen-3-sulfonylchlorid |
| 3-Thiophenesulfonyl chloride,5-nitro |
| 5-nitro-thiophene-3-sulfonyl chloride |