bis(trimethylsilylmethyl)indiganylmethyl-trimethylsilane structure
|
Common Name | bis(trimethylsilylmethyl)indiganylmethyl-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 69833-15-4 | Molecular Weight | 376.46500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H33InSi3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(trimethylsilylmethyl)indiganylmethyl-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H33InSi3 |
|---|---|
| Molecular Weight | 376.46500 |
| Exact Mass | 376.09300 |
| LogP | 5.49420 |
| InChIKey | QYRRRENPEMIKHL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C[In](C[Si](C)(C)C)C[Si](C)(C)C |
|
~%
bis(trimethylsi... CAS#:69833-15-4 |
| Literature: Perez; Sestelo; Sarandeses Journal of the American Chemical Society, 2001 , vol. 123, # 18 p. 4155 - 4160 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| [In(trimethylsilylmethyl)3] |
| In(CH2SiMe3)3 |
| [Ga(CH2SiMe3)3] |
| Indium,tris[(trimethylsilyl)methyl] |
| ((trimethylsilyl)methyl)indium |
| tris(trimethylsilylmethyl)indium |