2-Chloro-3-[(2-hydroxyethyl)amino]-1,4-naphthoquinone structure
|
Common Name | 2-Chloro-3-[(2-hydroxyethyl)amino]-1,4-naphthoquinone | ||
|---|---|---|---|---|
| CAS Number | 69844-34-4 | Molecular Weight | 251.66600 | |
| Density | 1.45g/cm3 | Boiling Point | 403.6ºC at 760 mmHg | |
| Molecular Formula | C12H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | 2-chloro-3-(2-hydroxyethylamino)naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 403.6ºC at 760 mmHg |
| Molecular Formula | C12H10ClNO3 |
| Molecular Weight | 251.66600 |
| Flash Point | 197.9ºC |
| Exact Mass | 251.03500 |
| PSA | 66.40000 |
| LogP | 1.48880 |
| Index of Refraction | 1.636 |
| InChIKey | MNAMDFQYYYJMKZ-UHFFFAOYSA-N |
| SMILES | O=C1C(Cl)=C(NCCO)C(=O)c2ccccc21 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: Inhibition of recombinant HNE (unknown origin) at <50 uM using N-methylsuccinyl-Ala-A...
Source: ChEMBL
Target: Neutrophil elastase
External Id: CHEMBL4314195
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Inhibition of recombinant Cdc25B (unknown origin) at <50 uM using OMFP as substrate m...
Source: ChEMBL
Target: M-phase inducer phosphatase 2
External Id: CHEMBL4314194
|
|
Name: Binding affinity to MKK7 (unknown origin) expressed in HEK293 cells assessed as disso...
Source: ChEMBL
Target: Dual specificity mitogen-activated protein kinase kinase 7
External Id: CHEMBL4314192
|
| EINECS 274-147-6 |
| 2-Chlor-3-(2-hydroxy-aethylamino)-[1,4]naphthochinon |
| 2-chloro-3-(2-hydroxy-ethylamino)-[1,4]naphthoquinone |