2-piperidin-1-ylethyl N-(2-ethoxyphenyl)carbamate structure
|
Common Name | 2-piperidin-1-ylethyl N-(2-ethoxyphenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 69852-95-5 | Molecular Weight | 292.37300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-piperidin-1-ylethyl N-(2-ethoxyphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H24N2O3 |
|---|---|
| Molecular Weight | 292.37300 |
| Exact Mass | 292.17900 |
| PSA | 54.29000 |
| LogP | 3.07120 |
| InChIKey | AKAUVJAKQZMDKP-UHFFFAOYSA-N |
| SMILES | CCOc1ccccc1NC(=O)OCCN1CCCCC1 |
|
~%
2-piperidin-1-y... CAS#:69852-95-5 |
| Literature: Soulier, Jean-Louis; Yang, Donglai; Bremont, Beatrice; Croci, Tiziano; Guzzi, Umberto; Langlois, Michel Journal of Medicinal Chemistry, 1997 , vol. 40, # 11 p. 1755 - 1761 |
|
~%
2-piperidin-1-y... CAS#:69852-95-5 |
| Literature: Soulier, Jean-Louis; Yang, Donglai; Bremont, Beatrice; Croci, Tiziano; Guzzi, Umberto; Langlois, Michel Journal of Medicinal Chemistry, 1997 , vol. 40, # 11 p. 1755 - 1761 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: Antagonist activity was calculated as the concentration which produced a 50% reductio...
Source: ChEMBL
Target: Cavia porcellus
External Id: CHEMBL684110
|
|
Name: Binding affinity at 5-hydroxytryptamine 4 receptor in rat striatal membranes by [3H]G...
Source: ChEMBL
Target: 5-hydroxytryptamine receptor 4
External Id: CHEMBL619047
|
|
Name: Agonist activity was assessed as the concentration which gave a 50% increase in the r...
Source: ChEMBL
Target: Cavia porcellus
External Id: CHEMBL684496
|
| o-ethoxyphenylcarbamic acid 2-piperidineethyl ester |
| Carbamic acid,(2-ethoxyphenyl)-,2-(1-piperidinyl)ethyl ester |
| 2-(piperidin-1-yl)ethyl(2-ethoxyphenyl)carbamate |