1-Methyl-4-(methylsulfonyl)bicyclo[2.2.2]octane structure
|
Common Name | 1-Methyl-4-(methylsulfonyl)bicyclo[2.2.2]octane | ||
|---|---|---|---|---|
| CAS Number | 69855-48-7 | Molecular Weight | 202.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-methylsulfonylbicyclo[2.2.2]octane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H18O2S |
|---|---|
| Molecular Weight | 202.31400 |
| Exact Mass | 202.10300 |
| PSA | 42.52000 |
| LogP | 3.22470 |
| InChIKey | TVLGUFAVQMZKKI-UHFFFAOYSA-N |
| SMILES | CC12CCC(S(C)(=O)=O)(CC1)CC2 |
|
~73%
1-Methyl-4-(met... CAS#:69855-48-7 |
| Literature: Kopecky, Jan; Smejkal, Jaroslav Collection of Czechoslovak Chemical Communications, 1980 , vol. 45, # 11 p. 2976 - 2978 |
|
~%
1-Methyl-4-(met... CAS#:69855-48-7 |
| Literature: Kopecky, Jan; Smejkal, Jaroslav Collection of Czechoslovak Chemical Communications, 1980 , vol. 45, # 11 p. 2976 - 2978 |
| methyl 4-methylbicyclo<2.2.2>oct-1-yl sulphone |
| Bicyclo[2.2.2]octane,1-methyl-4-(methylsulfonyl) |
| 1-Methyl-4-(methylsulfonyl)bicyclo[2.2.2]octane |