benzene-1,4-diol,4-tert-butylphenol,formaldehyde structure
|
Common Name | benzene-1,4-diol,4-tert-butylphenol,formaldehyde | ||
|---|---|---|---|---|
| CAS Number | 69856-03-7 | Molecular Weight | 290.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzene-1,4-diol,4-tert-butylphenol,formaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H22O4 |
|---|---|
| Molecular Weight | 290.35400 |
| Exact Mass | 290.15200 |
| PSA | 77.76000 |
| LogP | 4.23850 |
| InChIKey | XECJVGAWHHFVTG-UHFFFAOYSA-N |
| SMILES | C=O.CC(C)(C)c1ccc(O)cc1.Oc1ccc(O)cc1 |
| Phenol,4-(1,1-dimethylethyl)-,polymer with formaldehyde and 1,4-benzenediol |
| Formaldehyde,polymer with 1,4-benzenediol and 4-(1,1-dimethylethyl)phenol |