[6-methyl-4,5-bis[(4-nitrobenzoyl)oxy]oxan-2-yl] 4-nitrobenzoate structure
|
Common Name | [6-methyl-4,5-bis[(4-nitrobenzoyl)oxy]oxan-2-yl] 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 69881-26-1 | Molecular Weight | 595.46800 | |
| Density | 1.53g/cm3 | Boiling Point | 766.8ºC at 760 mmHg | |
| Molecular Formula | C27H21N3O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.2ºC | |
| Name | [2-methyl-3,6-bis[(4-nitrobenzoyl)oxy]oxan-4-yl] 4-nitrobenzoate |
|---|
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 766.8ºC at 760 mmHg |
| Molecular Formula | C27H21N3O13 |
| Molecular Weight | 595.46800 |
| Flash Point | 289.2ºC |
| Exact Mass | 595.10700 |
| PSA | 225.59000 |
| LogP | 5.72370 |
| Index of Refraction | 1.649 |
| InChIKey | TUKROMYUXCQTMV-UHFFFAOYSA-N |
| SMILES | CC1OC(OC(=O)c2ccc([N+](=O)[O-])cc2)CC(OC(=O)c2ccc([N+](=O)[O-])cc2)C1OC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
[6-methyl-4,5-b... CAS#:69881-26-1 |
| Literature: Zorbach; Payne Journal of the American Chemical Society, 1958 , vol. 80, p. 5564,5566 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |