Evodine structure
|
Common Name | Evodine | ||
|---|---|---|---|---|
| CAS Number | 6989-38-4 | Molecular Weight | 329.347 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 507.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H19NO5 | Melting Point | 153-154ºC | |
| MSDS | N/A | Flash Point | 260.4±30.1 °C | |
Use of EvodineEvodine, the major limonoid of Evodiae Fuctus, is a potent P-gp inhibitor. Evodine has protection against glutamateinduced toxicity by preserving the antioxidant defense system[1]. |
| Name | 1-[(4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl)oxy]-3-methyl-3-buten-2 -ol |
|---|---|
| Synonym | More Synonyms |
| Description | Evodine, the major limonoid of Evodiae Fuctus, is a potent P-gp inhibitor. Evodine has protection against glutamateinduced toxicity by preserving the antioxidant defense system[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 507.0±50.0 °C at 760 mmHg |
| Melting Point | 153-154ºC |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.347 |
| Flash Point | 260.4±30.1 °C |
| Exact Mass | 329.126312 |
| PSA | 73.95000 |
| LogP | 3.26 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | LNJTUUHDKCPQAA-UHFFFAOYSA-N |
| SMILES | C=C(C)C(O)COc1ccc2c(OC)c3ccoc3nc2c1OC |
| Storage condition | 2-8C |
| 1-[(4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl)oxy]-3-methyl-3-buten-2-ol |
| (-)-1'-(2-phenylethylene)-ditryptophenaline |
| (-)-1-(4,8-dimethoxy-furo[2,3-b]quinolin-7-yloxy)-3-methyl-but-3-en-2-ol |
| Evodine |