(R)-(-)-2-(P-TOLUENESULFONATE)-1,2-PROPANOL structure
|
Common Name | (R)-(-)-2-(P-TOLUENESULFONATE)-1,2-PROPANOL | ||
|---|---|---|---|---|
| CAS Number | 69891-44-7 | Molecular Weight | 230.28100 | |
| Density | 1.246g/cm3 | Boiling Point | 379.5ºC at 760 mmHg | |
| Molecular Formula | C10H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.3ºC | |
| Name | [(2R)-1-hydroxypropan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 379.5ºC at 760 mmHg |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28100 |
| Flash Point | 183.3ºC |
| Exact Mass | 230.06100 |
| PSA | 71.98000 |
| LogP | 2.16190 |
| Index of Refraction | 1.532 |
| InChIKey | UADUJNAWMVEFHR-SECBINFHSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)CO)cc1 |
|
~61%
(R)-(-)-2-(P-TO... CAS#:69891-44-7 |
| Literature: Mathieu-Pelta, Isabel; Evans, Slayton A. Journal of Organic Chemistry, 1992 , vol. 57, # 12 p. 3409 - 3413 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| R-2-(4-Methylbenzenesulfonyloxy)-1-propanol |
| (R)-(-)-2-(p-toluenesulfonate)-1,2-Propaniol |
| (R)-2-(((4-methylphenyl)sulfonyl)oxy)-1-propanol |